C23H20N8O4 — CID 53239562
N-[[5-[2-(2-imidazol-1-ylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]-3-methyl-4-nitrobenzamide (PubChem CID 53239562) has the molecular formula C23H20N8O4 and a molecular weight of 472.47 g/mol. Its IUPAC name is N-[[5-[2-(2-imidazol-1-ylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[[5-[2-(2-imidazol-1-ylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 53239562 |
| Molecular Formula | C23H20N8O4 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-[[5-[2-(2-imidazol-1-ylethyl)indazol-3-yl]-1,2,4-oxadiazol-3-yl]methyl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NCc2noc(-c3c4ccccc4nn3CCn3ccnc3)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H20N8O4/c1-15-12-16(6-7-19(15)31(33)34)22(32)25-13-20-26-23(35-28-20)21-17-4-2-3-5-18(17)27-30(21)11-10-29-9-8-24-14-29/h2-9,12,14H,10-11,13H2,1H3,(H,25,32) |
| InChIKey | OTYIDDDCZAETPY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|