C6H9N3S — CID 5323972
N-methyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]thiadiazol-3-imine (PubChem CID 5323972) has the molecular formula C6H9N3S and a molecular weight of 155.23 g/mol. Its IUPAC name is N-methyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]thiadiazol-3-imine.
| Compound Name | N-methyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]thiadiazol-3-imine |
|---|---|
| PubChem CID | 5323972 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | N-methyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]thiadiazol-3-imine |
| SMILES | C/N=c1\snc2n1CCC2 |
| InChI | InChI=1S/C6H9N3S/c1-7-6-9-4-2-3-5(9)8-10-6/h2-4H2,1H3/b7-6- |
| InChIKey | BXHUDWPGNVAFJL-SREVYHEPSA-N |
| XLogP | 0.42 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|