C29H31F6N3O2 — CID 53239824
1,1,1,3,3,3-hexafluoro-2-[3-propan-2-yloxy-4-[4-[[4-(pyridin-4-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol (PubChem CID 53239824) has the molecular formula C29H31F6N3O2 and a molecular weight of 567.57 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[3-propan-2-yloxy-4-[4-[[4-(pyridin-4-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[3-propan-2-yloxy-4-[4-[[4-(pyridin-4-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 53239824 |
| Molecular Formula | C29H31F6N3O2 |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[3-propan-2-yloxy-4-[4-[[4-(pyridin-4-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
| SMILES | CC(C)Oc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1-c1ccc(CN2CCN(Cc3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C29H31F6N3O2/c1-20(2)40-26-17-24(27(39,28(30,31)32)29(33,34)35)7-8-25(26)23-5-3-21(4-6-23)18-37-13-15-38(16-14-37)19-22-9-11-36-12-10-22/h3-12,17,20,39H,13-16,18-19H2,1-2H3 |
| InChIKey | OBWXFIWBJYQKSE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |