About 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide
2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide (PubChem CID 53240020) has the molecular formula C21H24N2O2S
and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide |
| PubChem CID | 53240020 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide |
| SMILES | CSC[C@H]1CN(Cc2ccccc2)C(=O)[C@H]1CC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H24N2O2S/c1-26-15-17-14-23(13-16-8-4-2-5-9-16)21(25)19(17)12-20(24)22-18-10-6-3-7-11-18/h2-11,17,19H,12-15H2,1H3,(H,22,24)/t17-,19+/m1/s1 |
| InChIKey | ZHVBSQRXPWXELK-MJGOQNOKSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide?
The IUPAC name of 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide (CID 53240020) is 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide.
What is the SMILES notation for 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide?
The canonical SMILES for 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide is CSC[C@H]1CN(Cc2ccccc2)C(=O)[C@H]1CC(=O)Nc1ccccc1.
What is the InChIKey of 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide?
The InChIKey is ZHVBSQRXPWXELK-MJGOQNOKSA-N. The full InChI is InChI=1S/C21H24N2O2S/c1-26-15-17-14-23(13-16-8-4-2-5-9-16)21(25)19(17)12-20(24)22-18-10-6-3-7-11-18/h2-11,17,19H,12-15H2,1H3,(H,22,24)/t17-,19+/m1/s1.
What are the key properties of 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide?
2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide has a molecular weight of 368.50 g/mol, XLogP of 3.65, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-1-benzyl-4-(methylsulfanylmethyl)-2-oxopyrrolidin-3-yl]-N-phenylacetamide is sourced from PubChem (CID 53240020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).