C10H16N2O4S3 — CID 53240165
(5aR,8S)-8-(2-methylsulfanylethyl)-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione (PubChem CID 53240165) has the molecular formula C10H16N2O4S3 and a molecular weight of 324.45 g/mol. Its IUPAC name is (5aR,8S)-8-(2-methylsulfanylethyl)-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione.
| Compound Name | (5aR,8S)-8-(2-methylsulfanylethyl)-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione |
|---|---|
| PubChem CID | 53240165 |
| Molecular Formula | C10H16N2O4S3 |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | (5aR,8S)-8-(2-methylsulfanylethyl)-1,1-dioxo-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione |
| SMILES | CSCC[C@@H]1NC(=O)[C@@H]2CSCCS(=O)(=O)N2C1=O |
| InChI | InChI=1S/C10H16N2O4S3/c1-17-3-2-7-10(14)12-8(9(13)11-7)6-18-4-5-19(12,15)16/h7-8H,2-6H2,1H3,(H,11,13)/t7-,8-/m0/s1 |
| InChIKey | BVQYSNBHPSZOAP-YUMQZZPRSA-N |
| XLogP | -0.49 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |