About CID 53240178
CID 53240178 (PubChem CID 53240178) has the molecular formula C15H14ClNO3S
and a molecular weight of 323.80 g/mol.
Molecular Properties
| Compound Name | CID 53240178 |
| PubChem CID | 53240178 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | — |
| SMILES | C[C@H]1N[S+](=O)([O-])c2cc(Cl)ccc2O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H14ClNO3S/c1-10-15(11-5-3-2-4-6-11)20-13-8-7-12(16)9-14(13)21(18,19)17-10/h2-10,15H,1H3,(H-,17,18,19)/t10-,15-/m1/s1 |
| InChIKey | AGHLGZVWOWVTMQ-MEBBXXQBSA-N |
| XLogP | 3.36 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 53240178 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53240178?
The IUPAC name of CID 53240178 (CID 53240178) is not available.
What is the SMILES notation for CID 53240178?
The canonical SMILES for CID 53240178 is C[C@H]1N[S+](=O)([O-])c2cc(Cl)ccc2O[C@H]1c1ccccc1.
What is the InChIKey of CID 53240178?
The InChIKey is AGHLGZVWOWVTMQ-MEBBXXQBSA-N. The full InChI is InChI=1S/C15H14ClNO3S/c1-10-15(11-5-3-2-4-6-11)20-13-8-7-12(16)9-14(13)21(18,19)17-10/h2-10,15H,1H3,(H-,17,18,19)/t10-,15-/m1/s1.
What are the key properties of CID 53240178?
CID 53240178 has a molecular weight of 323.80 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53240178 is sourced from PubChem (CID 53240178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).