C16H14N2O4S2 — CID 53240199
(5aR)-7-naphthalen-1-yl-1,1-dioxo-2,3,5,5a-tetrahydroimidazo[1,5-b][1,5,2]dithiazepine-6,8-dione (PubChem CID 53240199) has the molecular formula C16H14N2O4S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (5aR)-7-naphthalen-1-yl-1,1-dioxo-2,3,5,5a-tetrahydroimidazo[1,5-b][1,5,2]dithiazepine-6,8-dione.
| Compound Name | (5aR)-7-naphthalen-1-yl-1,1-dioxo-2,3,5,5a-tetrahydroimidazo[1,5-b][1,5,2]dithiazepine-6,8-dione |
|---|---|
| PubChem CID | 53240199 |
| Molecular Formula | C16H14N2O4S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | (5aR)-7-naphthalen-1-yl-1,1-dioxo-2,3,5,5a-tetrahydroimidazo[1,5-b][1,5,2]dithiazepine-6,8-dione |
| SMILES | O=C1[C@@H]2CSCCS(=O)(=O)N2C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C16H14N2O4S2/c19-15-14-10-23-8-9-24(21,22)18(14)16(20)17(15)13-7-3-5-11-4-1-2-6-12(11)13/h1-7,14H,8-10H2/t14-/m0/s1 |
| InChIKey | GDQZIBYOZCRALP-AWEZNQCLSA-N |
| XLogP | 2.05 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|