C11H13F2NO2S2 — CID 53240242
2-[(2,4-difluorophenyl)methyl]-1,5,2-dithiazepane 1,1-dioxide (PubChem CID 53240242) has the molecular formula C11H13F2NO2S2 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methyl]-1,5,2-dithiazepane 1,1-dioxide.
| Compound Name | 2-[(2,4-difluorophenyl)methyl]-1,5,2-dithiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 53240242 |
| Molecular Formula | C11H13F2NO2S2 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methyl]-1,5,2-dithiazepane 1,1-dioxide |
| SMILES | O=S1(=O)CCSCCN1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C11H13F2NO2S2/c12-10-2-1-9(11(13)7-10)8-14-3-4-17-5-6-18(14,15)16/h1-2,7H,3-6,8H2 |
| InChIKey | CEWYBVVIGPTNFQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |