C15H16ClIN6O2 — CID 53240414
(1,3-dimethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide (PubChem CID 53240414) has the molecular formula C15H16ClIN6O2 and a molecular weight of 474.69 g/mol. Its IUPAC name is (1,3-dimethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide.
| Compound Name | (1,3-dimethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide |
|---|---|
| PubChem CID | 53240414 |
| Molecular Formula | C15H16ClIN6O2 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | (1,3-dimethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate iodide |
| SMILES | Cn1c(COC(=O)c2nc(Cl)c(N)nc2N)[n+](C)c2ccccc21.[I-] |
| InChI | InChI=1S/C15H15ClN6O2.HI/c1-21-8-5-3-4-6-9(8)22(2)10(21)7-24-15(23)11-13(17)20-14(18)12(16)19-11;/h3-6H,7H2,1-2H3,(H3-,17,18,20,23);1H |
| InChIKey | OIZTUAJZOQTZLC-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|