C15H16ClN6O2+ — CID 53240415
(1,3-dimethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate (PubChem CID 53240415) has the molecular formula C15H16ClN6O2+ and a molecular weight of 347.79 g/mol. Its IUPAC name is (1,3-dimethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate.
| Compound Name | (1,3-dimethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate |
|---|---|
| PubChem CID | 53240415 |
| Molecular Formula | C15H16ClN6O2+ |
| Molecular Weight | 347.79 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (1,3-dimethylbenzimidazol-3-ium-2-yl)methyl 3,5-diamino-6-chloropyrazine-2-carboxylate |
| SMILES | Cn1c(COC(=O)c2nc(Cl)c(N)nc2N)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C15H15ClN6O2/c1-21-8-5-3-4-6-9(8)22(2)10(21)7-24-15(23)11-13(17)20-14(18)12(16)19-11/h3-6H,7H2,1-2H3,(H3-,17,18,20,23)/p+1 |
| InChIKey | ZBFSWHXCTXRJOR-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.79 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|