C18H16F3N3O4 — CID 53240510
5,5-dimethyl-3-[6-[4-methyl-3-(trifluoromethoxy)phenoxy]-3-pyridinyl]imidazolidine-2,4-dione (PubChem CID 53240510) has the molecular formula C18H16F3N3O4 and a molecular weight of 395.34 g/mol. Its IUPAC name is 5,5-dimethyl-3-[6-[4-methyl-3-(trifluoromethoxy)phenoxy]-3-pyridinyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[6-[4-methyl-3-(trifluoromethoxy)phenoxy]-3-pyridinyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 53240510 |
| Molecular Formula | C18H16F3N3O4 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 5,5-dimethyl-3-[6-[4-methyl-3-(trifluoromethoxy)phenoxy]-3-pyridinyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)NC(C)(C)C3=O)cn2)cc1OC(F)(F)F |
| InChI | InChI=1S/C18H16F3N3O4/c1-10-4-6-12(8-13(10)28-18(19,20)21)27-14-7-5-11(9-22-14)24-15(25)17(2,3)23-16(24)26/h4-9H,1-3H3,(H,23,26) |
| InChIKey | VXCFTYWNOQFXHH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|