(3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid

C13H18FNO3 — CID 53240594

IUPAC(3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid
SMILESC[C@@H](C[C@H](CN)CC(=O)O)Oc1cccc(F)c1
InChIInChI=1S/C13H18FNO3/c1-9(5-10(8-15)6-13(16)17)18-12-4-2-3-11(14)7-12/h2-4,7,9-10H,5-6,8,15H2,1H3,(H,16,17)/t9-,10-/m0/s1
InChIKeyCQARKITVLVJYGA-UWVGGRQHSA-N
MW255.29 g/mol
LogP2.03
Rot. Bonds7

About (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid

(3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid (PubChem CID 53240594) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid.

Molecular Properties

Compound Name(3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid
PubChem CID53240594
Molecular FormulaC13H18FNO3
Molecular Weight255.29 g/mol
Exact Mass255.13
IUPAC Name(3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid
SMILESC[C@@H](C[C@H](CN)CC(=O)O)Oc1cccc(F)c1
InChIInChI=1S/C13H18FNO3/c1-9(5-10(8-15)6-13(16)17)18-12-4-2-3-11(14)7-12/h2-4,7,9-10H,5-6,8,15H2,1H3,(H,16,17)/t9-,10-/m0/s1
InChIKeyCQARKITVLVJYGA-UWVGGRQHSA-N
XLogP2.03
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.29
LogP ≤ 52.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid?
The IUPAC name of (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid (CID 53240594) is (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid.
What is the SMILES notation for (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid?
The canonical SMILES for (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid is C[C@@H](C[C@H](CN)CC(=O)O)Oc1cccc(F)c1.
What is the InChIKey of (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid?
The InChIKey is CQARKITVLVJYGA-UWVGGRQHSA-N. The full InChI is InChI=1S/C13H18FNO3/c1-9(5-10(8-15)6-13(16)17)18-12-4-2-3-11(14)7-12/h2-4,7,9-10H,5-6,8,15H2,1H3,(H,16,17)/t9-,10-/m0/s1.
What are the key properties of (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid?
(3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid has a molecular weight of 255.29 g/mol, XLogP of 2.03, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3-(aminomethyl)-5-(3-fluorophenoxy)hexanoic acid is sourced from PubChem (CID 53240594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).