C20H17F7N4O3 — CID 53240812
N-[3-[(4R)-2-amino-5,5-difluoro-4-methyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide (PubChem CID 53240812) has the molecular formula C20H17F7N4O3 and a molecular weight of 494.37 g/mol. Its IUPAC name is N-[3-[(4R)-2-amino-5,5-difluoro-4-methyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-[(4R)-2-amino-5,5-difluoro-4-methyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 53240812 |
| Molecular Formula | C20H17F7N4O3 |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[3-[(4R)-2-amino-5,5-difluoro-4-methyl-6H-1,3-oxazin-4-yl]-4-fluorophenyl]-5-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carboxamide |
| SMILES | C[C@]1(c2cc(NC(=O)c3ccc(OCC(F)(F)C(F)F)cn3)ccc2F)N=C(N)OCC1(F)F |
| InChI | InChI=1S/C20H17F7N4O3/c1-18(20(26,27)9-34-17(28)31-18)12-6-10(2-4-13(12)21)30-15(32)14-5-3-11(7-29-14)33-8-19(24,25)16(22)23/h2-7,16H,8-9H2,1H3,(H2,28,31)(H,30,32)/t18-/m1/s1 |
| InChIKey | UHUWMAOCKWUXRP-GOSISDBHSA-N |
| XLogP | 3.95 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|