About 1,3-diphenylpyrrole
1,3-diphenylpyrrole (PubChem CID 5324091) has the molecular formula C16H13N
and a molecular weight of 219.29 g/mol. Its IUPAC name is 1,3-diphenylpyrrole.
Molecular Properties
| Compound Name | 1,3-diphenylpyrrole |
| PubChem CID | 5324091 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1,3-diphenylpyrrole |
| SMILES | c1ccc(-c2ccn(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C16H13N/c1-3-7-14(8-4-1)15-11-12-17(13-15)16-9-5-2-6-10-16/h1-13H |
| InChIKey | FNADOEOZHJKIQH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-diphenylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diphenylpyrrole?
The IUPAC name of 1,3-diphenylpyrrole (CID 5324091) is 1,3-diphenylpyrrole.
What is the SMILES notation for 1,3-diphenylpyrrole?
The canonical SMILES for 1,3-diphenylpyrrole is c1ccc(-c2ccn(-c3ccccc3)c2)cc1.
What is the InChIKey of 1,3-diphenylpyrrole?
The InChIKey is FNADOEOZHJKIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N/c1-3-7-14(8-4-1)15-11-12-17(13-15)16-9-5-2-6-10-16/h1-13H.
What are the key properties of 1,3-diphenylpyrrole?
1,3-diphenylpyrrole has a molecular weight of 219.29 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diphenylpyrrole is sourced from PubChem (CID 5324091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).