About 3-phenyl-1H-pyrrole
3-phenyl-1H-pyrrole (PubChem CID 5324110) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is 3-phenyl-1H-pyrrole.
Molecular Properties
| Compound Name | 3-phenyl-1H-pyrrole |
| PubChem CID | 5324110 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 3-phenyl-1H-pyrrole |
| SMILES | c1ccc(-c2cc[nH]c2)cc1 |
| InChI | InChI=1S/C10H9N/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-8,11H |
| InChIKey | LJDRAKFYYGCAQC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-phenyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1H-pyrrole?
The IUPAC name of 3-phenyl-1H-pyrrole (CID 5324110) is 3-phenyl-1H-pyrrole.
What is the SMILES notation for 3-phenyl-1H-pyrrole?
The canonical SMILES for 3-phenyl-1H-pyrrole is c1ccc(-c2cc[nH]c2)cc1.
What is the InChIKey of 3-phenyl-1H-pyrrole?
The InChIKey is LJDRAKFYYGCAQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N/c1-2-4-9(5-3-1)10-6-7-11-8-10/h1-8,11H.
What are the key properties of 3-phenyl-1H-pyrrole?
3-phenyl-1H-pyrrole has a molecular weight of 143.19 g/mol, XLogP of 2.68, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1H-pyrrole is sourced from PubChem (CID 5324110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).