C17H15F3N4O4 — CID 53241109
5,5-dimethyl-3-[2-[4-methyl-3-(trifluoromethoxy)phenoxy]pyrimidin-5-yl]imidazolidine-2,4-dione (PubChem CID 53241109) has the molecular formula C17H15F3N4O4 and a molecular weight of 396.33 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[4-methyl-3-(trifluoromethoxy)phenoxy]pyrimidin-5-yl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[4-methyl-3-(trifluoromethoxy)phenoxy]pyrimidin-5-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 53241109 |
| Molecular Formula | C17H15F3N4O4 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 5,5-dimethyl-3-[2-[4-methyl-3-(trifluoromethoxy)phenoxy]pyrimidin-5-yl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(Oc2ncc(N3C(=O)NC(C)(C)C3=O)cn2)cc1OC(F)(F)F |
| InChI | InChI=1S/C17H15F3N4O4/c1-9-4-5-11(6-12(9)28-17(18,19)20)27-14-21-7-10(8-22-14)24-13(25)16(2,3)23-15(24)26/h4-8H,1-3H3,(H,23,26) |
| InChIKey | RKJVNBMHIUOWSI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|