C17H19N3O — CID 53241125
(4aS)-8-pyridin-3-yl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazepine (PubChem CID 53241125) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is (4aS)-8-pyridin-3-yl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazepine.
| Compound Name | (4aS)-8-pyridin-3-yl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazepine |
|---|---|
| PubChem CID | 53241125 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (4aS)-8-pyridin-3-yl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[2,1-d][1,5]benzoxazepine |
| SMILES | c1cncc(-c2cccc3c2OCC[C@H]2CNCCN32)c1 |
| InChI | InChI=1S/C17H19N3O/c1-4-15(13-3-2-7-18-11-13)17-16(5-1)20-9-8-19-12-14(20)6-10-21-17/h1-5,7,11,14,19H,6,8-10,12H2/t14-/m0/s1 |
| InChIKey | KGFQVLSYFCFHQS-AWEZNQCLSA-N |
| XLogP | 2.31 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |