About [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate
[(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 53241254) has the molecular formula C19H17BrN2O6S
and a molecular weight of 481.32 g/mol. Its IUPAC name is [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
Molecular Properties
| Compound Name | [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| PubChem CID | 53241254 |
| Molecular Formula | C19H17BrN2O6S |
| Molecular Weight | 481.32 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)ONS(=O)(=O)c1ccccc1Br)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H17BrN2O6S/c1-11(2)16(22-17(23)12-7-3-4-8-13(12)18(22)24)19(25)28-21-29(26,27)15-10-6-5-9-14(15)20/h3-11,16,21H,1-2H3/t16-/m0/s1 |
| InChIKey | ZFMBNLXLHTULAB-INIZCTEOSA-N |
| XLogP | 2.51 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate?
The IUPAC name of [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (CID 53241254) is [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
What is the SMILES notation for [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate?
The canonical SMILES for [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate is CC(C)[C@@H](C(=O)ONS(=O)(=O)c1ccccc1Br)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate?
The InChIKey is ZFMBNLXLHTULAB-INIZCTEOSA-N. The full InChI is InChI=1S/C19H17BrN2O6S/c1-11(2)16(22-17(23)12-7-3-4-8-13(12)18(22)24)19(25)28-21-29(26,27)15-10-6-5-9-14(15)20/h3-11,16,21H,1-2H3/t16-/m0/s1.
What are the key properties of [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate?
[(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate has a molecular weight of 481.32 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-bromophenyl)sulfonylamino] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate is sourced from PubChem (CID 53241254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).