About (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide
(5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide (PubChem CID 5324147) has the molecular formula C10H13NOS
and a molecular weight of 195.29 g/mol. Its IUPAC name is (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide.
Molecular Properties
| Compound Name | (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide |
| PubChem CID | 5324147 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide |
| SMILES | C[C@H]1CCN=S1(=O)c1ccccc1 |
| InChI | InChI=1S/C10H13NOS/c1-9-7-8-11-13(9,12)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3/t9-,13?/m0/s1 |
| InChIKey | KEGJEXCRAHRFPK-LLTODGECSA-N |
| XLogP | 2.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide?
The IUPAC name of (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide (CID 5324147) is (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide.
What is the SMILES notation for (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide?
The canonical SMILES for (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide is C[C@H]1CCN=S1(=O)c1ccccc1.
What is the InChIKey of (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide?
The InChIKey is KEGJEXCRAHRFPK-LLTODGECSA-N. The full InChI is InChI=1S/C10H13NOS/c1-9-7-8-11-13(9,12)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3/t9-,13?/m0/s1.
What are the key properties of (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide?
(5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide has a molecular weight of 195.29 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methyl-1-phenyl-4,5-dihydro-3H-1,2-thiazole 1-oxide is sourced from PubChem (CID 5324147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).