C18H19N3O3 — CID 53241836
3-[6-(2,6-dimethylphenoxy)-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 53241836) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-[6-(2,6-dimethylphenoxy)-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[6-(2,6-dimethylphenoxy)-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 53241836 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-[6-(2,6-dimethylphenoxy)-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1cccc(C)c1Oc1ccc(N2C(=O)NC(C)(C)C2=O)cn1 |
| InChI | InChI=1S/C18H19N3O3/c1-11-6-5-7-12(2)15(11)24-14-9-8-13(10-19-14)21-16(22)18(3,4)20-17(21)23/h5-10H,1-4H3,(H,20,23) |
| InChIKey | ZJXSKCKSDWJWDC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|