C29H29F3N3O5S+ — CID 53242023
[3-butyl-2-[2-[(2S)-2-hydroxypropoxy]-5-(trifluoromethyl)benzoyl]imino-[1,3]thiazolo[4,5-c]pyridin-5-ium-5-yl]methyl benzoate (PubChem CID 53242023) has the molecular formula C29H29F3N3O5S+ and a molecular weight of 588.63 g/mol. Its IUPAC name is [3-butyl-2-[2-[(2S)-2-hydroxypropoxy]-5-(trifluoromethyl)benzoyl]imino-[1,3]thiazolo[4,5-c]pyridin-5-ium-5-yl]methyl benzoate.
| Compound Name | [3-butyl-2-[2-[(2S)-2-hydroxypropoxy]-5-(trifluoromethyl)benzoyl]imino-[1,3]thiazolo[4,5-c]pyridin-5-ium-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 53242023 |
| Molecular Formula | C29H29F3N3O5S+ |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | [3-butyl-2-[2-[(2S)-2-hydroxypropoxy]-5-(trifluoromethyl)benzoyl]imino-[1,3]thiazolo[4,5-c]pyridin-5-ium-5-yl]methyl benzoate |
| SMILES | CCCCn1/c(=N/C(=O)c2cc(C(F)(F)F)ccc2OC[C@H](C)O)sc2cc[n+](COC(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C29H29F3N3O5S/c1-3-4-13-35-23-16-34(18-40-27(38)20-8-6-5-7-9-20)14-12-25(23)41-28(35)33-26(37)22-15-21(29(30,31)32)10-11-24(22)39-17-19(2)36/h5-12,14-16,19,36H,3-4,13,17-18H2,1-2H3/q+1/b33-28-/t19-/m0/s1 |
| InChIKey | DRNUQQJJTCCLEH-IFDWCTDOSA-N |
| XLogP | 5.12 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|