C17H17N5O3 — CID 53242184
(12R,13S)-12,13-dimethyl-N-(5-methyl-1,2-oxazol-3-yl)-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxamide (PubChem CID 53242184) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is (12R,13S)-12,13-dimethyl-N-(5-methyl-1,2-oxazol-3-yl)-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxamide.
| Compound Name | (12R,13S)-12,13-dimethyl-N-(5-methyl-1,2-oxazol-3-yl)-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 53242184 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (12R,13S)-12,13-dimethyl-N-(5-methyl-1,2-oxazol-3-yl)-10-oxo-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc3cc4n(c3n2)[C@@H](C)[C@@H](C)NC4=O)no1 |
| InChI | InChI=1S/C17H17N5O3/c1-8-6-14(21-25-8)20-16(23)12-5-4-11-7-13-17(24)18-9(2)10(3)22(13)15(11)19-12/h4-7,9-10H,1-3H3,(H,18,24)(H,20,21,23)/t9-,10+/m1/s1 |
| InChIKey | UJUORBDBVOLWSF-ZJUUUORDSA-N |
| XLogP | 2.28 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |