C22H22N6O2 — CID 53242187
N-(1-ethylbenzimidazol-2-yl)-14-methyl-10-oxo-1,3,11-triazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraene-4-carboxamide (PubChem CID 53242187) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-(1-ethylbenzimidazol-2-yl)-14-methyl-10-oxo-1,3,11-triazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraene-4-carboxamide.
| Compound Name | N-(1-ethylbenzimidazol-2-yl)-14-methyl-10-oxo-1,3,11-triazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 53242187 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-(1-ethylbenzimidazol-2-yl)-14-methyl-10-oxo-1,3,11-triazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraene-4-carboxamide |
| SMILES | CCn1c(NC(=O)c2ccc3cc4n(c3n2)C(C)CCNC4=O)nc2ccccc21 |
| InChI | InChI=1S/C22H22N6O2/c1-3-27-17-7-5-4-6-15(17)25-22(27)26-20(29)16-9-8-14-12-18-21(30)23-11-10-13(2)28(18)19(14)24-16/h4-9,12-13H,3,10-11H2,1-2H3,(H,23,30)(H,25,26,29) |
| InChIKey | JSMQKJNGBBRBMO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |