C26H23BrN2O5S — CID 53242328
N-[(1S,2R)-1-(4-bromophenyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-oxobutyl]-4-methylbenzenesulfonamide (PubChem CID 53242328) has the molecular formula C26H23BrN2O5S and a molecular weight of 555.45 g/mol. Its IUPAC name is N-[(1S,2R)-1-(4-bromophenyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-oxobutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S,2R)-1-(4-bromophenyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-oxobutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 53242328 |
| Molecular Formula | C26H23BrN2O5S |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | N-[(1S,2R)-1-(4-bromophenyl)-2-[(1,3-dioxoisoindol-2-yl)methyl]-3-oxobutyl]-4-methylbenzenesulfonamide |
| SMILES | CC(=O)[C@H](CN1C(=O)c2ccccc2C1=O)[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H23BrN2O5S/c1-16-7-13-20(14-8-16)35(33,34)28-24(18-9-11-19(27)12-10-18)23(17(2)30)15-29-25(31)21-5-3-4-6-22(21)26(29)32/h3-14,23-24,28H,15H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | TWERUPXKNSUUNL-BJKOFHAPSA-N |
| XLogP | 4.28 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|