C56H46N4O2 — CID 53242543
5,15-bis[2-(4-methoxyphenyl)ethynyl]-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin (PubChem CID 53242543) has the molecular formula C56H46N4O2 and a molecular weight of 807.01 g/mol. Its IUPAC name is 5,15-bis[2-(4-methoxyphenyl)ethynyl]-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 5,15-bis[2-(4-methoxyphenyl)ethynyl]-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 53242543 |
| Molecular Formula | C56H46N4O2 |
| Molecular Weight | 807.01 g/mol |
| Exact Mass | 806.36 |
| IUPAC Name | 5,15-bis[2-(4-methoxyphenyl)ethynyl]-10,20-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
| SMILES | COc1ccc(C#Cc2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(C#Cc4ccc(OC)cc4)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C56H46N4O2/c1-33-29-35(3)53(36(4)30-33)55-49-25-21-45(57-49)43(19-13-39-9-15-41(61-7)16-10-39)47-23-27-51(59-47)56(54-37(5)31-34(2)32-38(54)6)52-28-24-48(60-52)44(46-22-26-50(55)58-46)20-14-40-11-17-42(62-8)18-12-40/h9-12,15-18,21-32,57,59H,1-8H3/b45-43-,46-44-,47-43-,48-44-,55-49+,55-50+,56-51+,56-52+ |
| InChIKey | MJMPORPXFNRZGL-GEOGGBKXSA-N |
| XLogP | 12.66 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.01 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|