C25H30FNO2 — CID 53242839
ethyl (2R)-2-(1-benzyl-5-fluoro-2-methylindol-3-yl)-5-methylhexanoate (PubChem CID 53242839) has the molecular formula C25H30FNO2 and a molecular weight of 395.52 g/mol. Its IUPAC name is ethyl (2R)-2-(1-benzyl-5-fluoro-2-methylindol-3-yl)-5-methylhexanoate.
| Compound Name | ethyl (2R)-2-(1-benzyl-5-fluoro-2-methylindol-3-yl)-5-methylhexanoate |
|---|---|
| PubChem CID | 53242839 |
| Molecular Formula | C25H30FNO2 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | ethyl (2R)-2-(1-benzyl-5-fluoro-2-methylindol-3-yl)-5-methylhexanoate |
| SMILES | CCOC(=O)[C@H](CCC(C)C)c1c(C)n(Cc2ccccc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C25H30FNO2/c1-5-29-25(28)21(13-11-17(2)3)24-18(4)27(16-19-9-7-6-8-10-19)23-14-12-20(26)15-22(23)24/h6-10,12,14-15,17,21H,5,11,13,16H2,1-4H3/t21-/m1/s1 |
| InChIKey | GWVQTJQNWJOTMA-OAQYLSRUSA-N |
| XLogP | 6.22 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|