C27H29N2O2+ — CID 53242855
3,19-dimethoxy-8,14-dipropyl-14-aza-8-azoniapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1,3,5,7,9(21),10,12,15(20),16,18-decaene (PubChem CID 53242855) has the molecular formula C27H29N2O2+ and a molecular weight of 413.54 g/mol. Its IUPAC name is 3,19-dimethoxy-8,14-dipropyl-14-aza-8-azoniapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1,3,5,7,9(21),10,12,15(20),16,18-decaene.
| Compound Name | 3,19-dimethoxy-8,14-dipropyl-14-aza-8-azoniapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1,3,5,7,9(21),10,12,15(20),16,18-decaene |
|---|---|
| PubChem CID | 53242855 |
| Molecular Formula | C27H29N2O2+ |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 3,19-dimethoxy-8,14-dipropyl-14-aza-8-azoniapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1,3,5,7,9(21),10,12,15(20),16,18-decaene |
| SMILES | CCCN1c2cccc(OC)c2-c2c3c(OC)cccc3[n+](CCC)c3cccc1c23 |
| InChI | InChI=1S/C27H29N2O2/c1-5-16-28-18-10-7-11-19-24(18)27(25-20(28)12-8-14-22(25)30-3)26-21(29(19)17-6-2)13-9-15-23(26)31-4/h7-15H,5-6,16-17H2,1-4H3/q+1 |
| InChIKey | FQYBGKVDYNPDFL-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 25.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|