About 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine
2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine (PubChem CID 53242882) has the molecular formula C20H9ClF6N2
and a molecular weight of 426.75 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine |
| PubChem CID | 53242882 |
| Molecular Formula | C20H9ClF6N2 |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine |
| SMILES | FC(F)(F)c1cc(-c2ccc3cnc4ccc(Cl)cc4c3n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H9ClF6N2/c21-14-2-4-17-15(8-14)18-10(9-28-17)1-3-16(29-18)11-5-12(19(22,23)24)7-13(6-11)20(25,26)27/h1-9H |
| InChIKey | BCKZFNRRMAHJNH-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine (CID 53242882) is 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine is FC(F)(F)c1cc(-c2ccc3cnc4ccc(Cl)cc4c3n2)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine?
The InChIKey is BCKZFNRRMAHJNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H9ClF6N2/c21-14-2-4-17-15(8-14)18-10(9-28-17)1-3-16(29-18)11-5-12(19(22,23)24)7-13(6-11)20(25,26)27/h1-9H.
What are the key properties of 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine?
2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine has a molecular weight of 426.75 g/mol, XLogP of 7.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)phenyl]-9-chlorobenzo[h][1,6]naphthyridine is sourced from PubChem (CID 53242882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).