C22H35NO3 — CID 53243060
(3S,6R,8R,10S,11R)-2,2,6-trimethyl-11-oct-1-ynyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecan-13-one (PubChem CID 53243060) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is (3S,6R,8R,10S,11R)-2,2,6-trimethyl-11-oct-1-ynyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecan-13-one.
| Compound Name | (3S,6R,8R,10S,11R)-2,2,6-trimethyl-11-oct-1-ynyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecan-13-one |
|---|---|
| PubChem CID | 53243060 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | (3S,6R,8R,10S,11R)-2,2,6-trimethyl-11-oct-1-ynyl-9,12-dioxa-1-azatricyclo[8.4.0.03,8]tetradecan-13-one |
| SMILES | CCCCCCC#C[C@H]1OC(=O)CN2[C@H]1O[C@@H]1C[C@H](C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C22H35NO3/c1-5-6-7-8-9-10-11-18-21-23(15-20(24)25-18)22(3,4)17-13-12-16(2)14-19(17)26-21/h16-19,21H,5-9,12-15H2,1-4H3/t16-,17-,18-,19-,21+/m1/s1 |
| InChIKey | TUCJFAZOJKMROS-FKAKKMJLSA-N |
| XLogP | 4.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|