C16H19NO4 — CID 53243133
(4-methoxyphenyl) (8S,8aR)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizine-8-carboxylate (PubChem CID 53243133) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (4-methoxyphenyl) (8S,8aR)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizine-8-carboxylate.
| Compound Name | (4-methoxyphenyl) (8S,8aR)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizine-8-carboxylate |
|---|---|
| PubChem CID | 53243133 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (4-methoxyphenyl) (8S,8aR)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizine-8-carboxylate |
| SMILES | COc1ccc(OC(=O)[C@H]2CCC(=O)N3CCC[C@H]23)cc1 |
| InChI | InChI=1S/C16H19NO4/c1-20-11-4-6-12(7-5-11)21-16(19)13-8-9-15(18)17-10-2-3-14(13)17/h4-7,13-14H,2-3,8-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | LCKNNJKQEUPYOP-UONOGXRCSA-N |
| XLogP | 2.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|