C21H14N6O — CID 5324328
(4-amino-3,5,8,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,3,6,8,11,13,15-heptaen-7-yl)-(1H-indol-3-yl)methanone (PubChem CID 5324328) has the molecular formula C21H14N6O and a molecular weight of 366.38 g/mol. Its IUPAC name is (4-amino-3,5,8,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,3,6,8,11,13,15-heptaen-7-yl)-(1H-indol-3-yl)methanone.
| Compound Name | (4-amino-3,5,8,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,3,6,8,11,13,15-heptaen-7-yl)-(1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 5324328 |
| Molecular Formula | C21H14N6O |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (4-amino-3,5,8,10-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1,3,6,8,11,13,15-heptaen-7-yl)-(1H-indol-3-yl)methanone |
| SMILES | Nc1nc2c([nH]1)c(C(=O)c1c[nH]c3ccccc13)nc1[nH]c3ccccc3c12 |
| InChI | InChI=1S/C21H14N6O/c22-21-26-16-15-11-6-2-4-8-14(11)24-20(15)25-18(17(16)27-21)19(28)12-9-23-13-7-3-1-5-10(12)13/h1-9,23H,(H,24,25)(H3,22,26,27) |
| InChIKey | WNDIVVRKTNRQAS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |