C21H20N2O2S — CID 53243323
(4R,7S)-4-(3-methoxyphenyl)-7-phenyl-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one (PubChem CID 53243323) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is (4R,7S)-4-(3-methoxyphenyl)-7-phenyl-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one.
| Compound Name | (4R,7S)-4-(3-methoxyphenyl)-7-phenyl-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
|---|---|
| PubChem CID | 53243323 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (4R,7S)-4-(3-methoxyphenyl)-7-phenyl-2-sulfanylidene-1,3,4,6,7,8-hexahydroquinazolin-5-one |
| SMILES | COc1cccc([C@H]2NC(=S)NC3=C2C(=O)C[C@@H](c2ccccc2)C3)c1 |
| InChI | InChI=1S/C21H20N2O2S/c1-25-16-9-5-8-14(10-16)20-19-17(22-21(26)23-20)11-15(12-18(19)24)13-6-3-2-4-7-13/h2-10,15,20H,11-12H2,1H3,(H2,22,23,26)/t15-,20+/m0/s1 |
| InChIKey | DTXOSKNUIFZONE-MGPUTAFESA-N |
| XLogP | 3.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|