About (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene
(2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene (PubChem CID 53243674) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene.
Molecular Properties
| Compound Name | (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene |
| PubChem CID | 53243674 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene |
| SMILES | CCCC[C@@H]1CCCCCCc2cc1c[nH]2 |
| InChI | InChI=1S/C15H25N/c1-2-3-8-13-9-6-4-5-7-10-15-11-14(13)12-16-15/h11-13,16H,2-10H2,1H3/t13-/m1/s1 |
| InChIKey | MWNUYJYLSHPECH-CYBMUJFWSA-N |
| XLogP | 4.80 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene?
The IUPAC name of (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene (CID 53243674) is (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene.
What is the SMILES notation for (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene?
The canonical SMILES for (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene is CCCC[C@@H]1CCCCCCc2cc1c[nH]2.
What is the InChIKey of (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene?
The InChIKey is MWNUYJYLSHPECH-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H25N/c1-2-3-8-13-9-6-4-5-7-10-15-11-14(13)12-16-15/h11-13,16H,2-10H2,1H3/t13-/m1/s1.
What are the key properties of (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene?
(2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene has a molecular weight of 219.37 g/mol, XLogP of 4.80, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-butyl-10-azabicyclo[7.2.1]dodeca-1(11),9(12)-diene is sourced from PubChem (CID 53243674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).