C18H16O4 — CID 53243739
(4R,5S)-4-benzoyl-5-(3,4-dimethylphenyl)-1,3-dioxolan-2-one (PubChem CID 53243739) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is (4R,5S)-4-benzoyl-5-(3,4-dimethylphenyl)-1,3-dioxolan-2-one.
| Compound Name | (4R,5S)-4-benzoyl-5-(3,4-dimethylphenyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 53243739 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (4R,5S)-4-benzoyl-5-(3,4-dimethylphenyl)-1,3-dioxolan-2-one |
| SMILES | Cc1ccc([C@@H]2OC(=O)O[C@H]2C(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C18H16O4/c1-11-8-9-14(10-12(11)2)16-17(22-18(20)21-16)15(19)13-6-4-3-5-7-13/h3-10,16-17H,1-2H3/t16-,17-/m0/s1 |
| InChIKey | NZRKKWJBTYNYRQ-IRXDYDNUSA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |