C14H9FN4O — CID 53243932
5-(18F)fluoro-2-(1-methylpyrrolo[2,3-b]pyridin-5-yl)-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 53243932) has the molecular formula C14H9FN4O and a molecular weight of 267.25 g/mol. Its IUPAC name is 5-(18F)fluoro-2-(1-methylpyrrolo[2,3-b]pyridin-5-yl)-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 5-(18F)fluoro-2-(1-methylpyrrolo[2,3-b]pyridin-5-yl)-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 53243932 |
| Molecular Formula | C14H9FN4O |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 5-(18F)fluoro-2-(1-methylpyrrolo[2,3-b]pyridin-5-yl)-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Cn1ccc2cc(-c3nc4ccc([18F])nc4o3)cnc21 |
| InChI | InChI=1S/C14H9FN4O/c1-19-5-4-8-6-9(7-16-12(8)19)13-17-10-2-3-11(15)18-14(10)20-13/h2-7H,1H3/i15-1 |
| InChIKey | WYQHKOHCTMNFAU-HUYCHCPVSA-N |
| XLogP | 2.92 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|