C21H36O2Si — CID 53243989
[(3S,3aS,9bS)-7-methoxy-3a-methyl-1,2,3,4,5,6,9,9b-octahydrocyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 53243989) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is [(3S,3aS,9bS)-7-methoxy-3a-methyl-1,2,3,4,5,6,9,9b-octahydrocyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,3aS,9bS)-7-methoxy-3a-methyl-1,2,3,4,5,6,9,9b-octahydrocyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53243989 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | [(3S,3aS,9bS)-7-methoxy-3a-methyl-1,2,3,4,5,6,9,9b-octahydrocyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COC1=CCC2=C(CC[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]23)C1 |
| InChI | InChI=1S/C21H36O2Si/c1-20(2,3)24(6,7)23-19-11-10-18-17-9-8-16(22-5)14-15(17)12-13-21(18,19)4/h8,18-19H,9-14H2,1-7H3/t18-,19-,21-/m0/s1 |
| InChIKey | JRXLIHZVYSDLTK-ZJOUEHCJSA-N |
| XLogP | 6.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|