C30H31N3O3 — CID 53244049
(S)-cyclohexyl-[(1S,3S,4R)-1-(4-nitrophenyl)-4-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]methanol (PubChem CID 53244049) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is (S)-cyclohexyl-[(1S,3S,4R)-1-(4-nitrophenyl)-4-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]methanol.
| Compound Name | (S)-cyclohexyl-[(1S,3S,4R)-1-(4-nitrophenyl)-4-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]methanol |
|---|---|
| PubChem CID | 53244049 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (S)-cyclohexyl-[(1S,3S,4R)-1-(4-nitrophenyl)-4-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-3-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2N[C@H]([C@@H](O)C3CCCCC3)[C@H](c3ccccc3)c3c2[nH]c2ccccc32)cc1 |
| InChI | InChI=1S/C30H31N3O3/c34-30(21-11-5-2-6-12-21)29-25(19-9-3-1-4-10-19)26-23-13-7-8-14-24(23)31-28(26)27(32-29)20-15-17-22(18-16-20)33(35)36/h1,3-4,7-10,13-18,21,25,27,29-32,34H,2,5-6,11-12H2/t25-,27+,29+,30+/m1/s1 |
| InChIKey | OYRDCOHWMHROSJ-NCDXVWQWSA-N |
| XLogP | 6.21 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|