About 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine
4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 5324413) has the molecular formula C6H5ClN4
and a molecular weight of 168.59 g/mol. Its IUPAC name is 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| PubChem CID | 5324413 |
| Molecular Formula | C6H5ClN4 |
| Molecular Weight | 168.59 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Nc1nc(Cl)c2cc[nH]c2n1 |
| InChI | InChI=1S/C6H5ClN4/c7-4-3-1-2-9-5(3)11-6(8)10-4/h1-2H,(H3,8,9,10,11) |
| InChIKey | VIVLSUIQHWGALQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.59 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine?
The IUPAC name of 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine (CID 5324413) is 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine is Nc1nc(Cl)c2cc[nH]c2n1.
What is the InChIKey of 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine?
The InChIKey is VIVLSUIQHWGALQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN4/c7-4-3-1-2-9-5(3)11-6(8)10-4/h1-2H,(H3,8,9,10,11).
What are the key properties of 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine?
4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine has a molecular weight of 168.59 g/mol, XLogP of 1.19, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7H-pyrrolo[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 5324413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).