About 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine
4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 5324414) has the molecular formula C7H6ClN3S
and a molecular weight of 199.67 g/mol. Its IUPAC name is 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 5324414 |
| Molecular Formula | C7H6ClN3S |
| Molecular Weight | 199.67 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | CSc1nc(Cl)c2cc[nH]c2n1 |
| InChI | InChI=1S/C7H6ClN3S/c1-12-7-10-5(8)4-2-3-9-6(4)11-7/h2-3H,1H3,(H,9,10,11) |
| InChIKey | WEGGBXZHIWVHOI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.67 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine (CID 5324414) is 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine is CSc1nc(Cl)c2cc[nH]c2n1.
What is the InChIKey of 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is WEGGBXZHIWVHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3S/c1-12-7-10-5(8)4-2-3-9-6(4)11-7/h2-3H,1H3,(H,9,10,11).
What are the key properties of 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine?
4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 199.67 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 5324414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).