C20H17N3O5 — CID 53244399
3-(1H-pyrrolo[3,2-c]pyridin-3-yl)-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione (PubChem CID 53244399) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is 3-(1H-pyrrolo[3,2-c]pyridin-3-yl)-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(1H-pyrrolo[3,2-c]pyridin-3-yl)-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 53244399 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3-(1H-pyrrolo[3,2-c]pyridin-3-yl)-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1cc(C2=C(c3c[nH]c4ccncc34)C(=O)NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C20H17N3O5/c1-26-14-6-10(7-15(27-2)18(14)28-3)16-17(20(25)23-19(16)24)12-9-22-13-4-5-21-8-11(12)13/h4-9,22H,1-3H3,(H,23,24,25) |
| InChIKey | JJIWTVPITVCQSQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|