C44H83N2O2+ — CID 53244550
3-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxycarbonylamino]propyl-trimethylazanium (PubChem CID 53244550) has the molecular formula C44H83N2O2+ and a molecular weight of 672.16 g/mol. Its IUPAC name is 3-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxycarbonylamino]propyl-trimethylazanium.
| Compound Name | 3-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxycarbonylamino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 53244550 |
| Molecular Formula | C44H83N2O2+ |
| Molecular Weight | 672.16 g/mol |
| Exact Mass | 671.64 |
| IUPAC Name | 3-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]oxycarbonylamino]propyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)NCCC[N+](C)(C)C |
| InChI | InChI=1S/C44H82N2O2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39-43(48-44(47)45-41-38-42-46(3,4)5)40-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23,43H,6-13,18-19,24-42H2,1-5H3/p+1/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | FGJRUKOBDBMMML-ZPPAUJSGSA-O |
| XLogP | 13.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.16 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|