About 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide
2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide (PubChem CID 53244783) has the molecular formula C15H21N3O3
and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide.
Molecular Properties
| Compound Name | 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide |
| PubChem CID | 53244783 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide |
| SMILES | CCN1CC(C)(C)OC(=O)C1CC(=O)Nc1cccnc1 |
| InChI | InChI=1S/C15H21N3O3/c1-4-18-10-15(2,3)21-14(20)12(18)8-13(19)17-11-6-5-7-16-9-11/h5-7,9,12H,4,8,10H2,1-3H3,(H,17,19) |
| InChIKey | WPZHUXNDEWIHSG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide?
The IUPAC name of 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide (CID 53244783) is 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide.
What is the SMILES notation for 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide?
The canonical SMILES for 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide is CCN1CC(C)(C)OC(=O)C1CC(=O)Nc1cccnc1.
What is the InChIKey of 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide?
The InChIKey is WPZHUXNDEWIHSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O3/c1-4-18-10-15(2,3)21-14(20)12(18)8-13(19)17-11-6-5-7-16-9-11/h5-7,9,12H,4,8,10H2,1-3H3,(H,17,19).
What are the key properties of 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide?
2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide has a molecular weight of 291.35 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-6,6-dimethyl-2-oxomorpholin-3-yl)-N-pyridin-3-ylacetamide is sourced from PubChem (CID 53244783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).