C15H21ClO — CID 5324496
(6S)-8-chloro-2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine (PubChem CID 5324496) has the molecular formula C15H21ClO and a molecular weight of 252.78 g/mol. Its IUPAC name is (6S)-8-chloro-2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine.
| Compound Name | (6S)-8-chloro-2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine |
|---|---|
| PubChem CID | 5324496 |
| Molecular Formula | C15H21ClO |
| Molecular Weight | 252.78 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (6S)-8-chloro-2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine |
| SMILES | Cc1cc2c(cc1Cl)[C@@H](C)CCCC(C)(C)O2 |
| InChI | InChI=1S/C15H21ClO/c1-10-6-5-7-15(3,4)17-14-8-11(2)13(16)9-12(10)14/h8-10H,5-7H2,1-4H3/t10-/m0/s1 |
| InChIKey | KJXMUNSAZJZNLR-JTQLQIEISA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.78 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |