About 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one
5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 5324531) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 5324531 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCn1c(C)nc2c(cnn2C)c1=O |
| InChI | InChI=1S/C9H12N4O/c1-4-13-6(2)11-8-7(9(13)14)5-10-12(8)3/h5H,4H2,1-3H3 |
| InChIKey | YOPAMBPHDSHWKU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one (CID 5324531) is 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one is CCn1c(C)nc2c(cnn2C)c1=O.
What is the InChIKey of 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is YOPAMBPHDSHWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-4-13-6(2)11-8-7(9(13)14)5-10-12(8)3/h5H,4H2,1-3H3.
What are the key properties of 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one?
5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 192.22 g/mol, XLogP of 0.46, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,6-dimethylpyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 5324531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).