C25H29FN4O2 — CID 53245327
1-[(2S,4R,5R)-5-[4-(4-fluorophenyl)triazol-1-yl]-4-hydroxy-2-phenylpiperidin-1-yl]hexan-1-one (PubChem CID 53245327) has the molecular formula C25H29FN4O2 and a molecular weight of 436.53 g/mol. Its IUPAC name is 1-[(2S,4R,5R)-5-[4-(4-fluorophenyl)triazol-1-yl]-4-hydroxy-2-phenylpiperidin-1-yl]hexan-1-one.
| Compound Name | 1-[(2S,4R,5R)-5-[4-(4-fluorophenyl)triazol-1-yl]-4-hydroxy-2-phenylpiperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 53245327 |
| Molecular Formula | C25H29FN4O2 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-[(2S,4R,5R)-5-[4-(4-fluorophenyl)triazol-1-yl]-4-hydroxy-2-phenylpiperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1C[C@@H](n2cc(-c3ccc(F)cc3)nn2)[C@H](O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H29FN4O2/c1-2-3-5-10-25(32)29-17-23(24(31)15-22(29)19-8-6-4-7-9-19)30-16-21(27-28-30)18-11-13-20(26)14-12-18/h4,6-9,11-14,16,22-24,31H,2-3,5,10,15,17H2,1H3/t22-,23+,24+/m0/s1 |
| InChIKey | YHHDQFXDFSRTRW-RBZQAINGSA-N |
| XLogP | 4.54 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|