C27H25FN4O2 — CID 53245599
4-[[3-(4-fluorophenyl)-7,8-dimethoxypyrazolo[4,3-c]quinolin-5-yl]methyl]-N,N-dimethylaniline (PubChem CID 53245599) has the molecular formula C27H25FN4O2 and a molecular weight of 456.52 g/mol. Its IUPAC name is 4-[[3-(4-fluorophenyl)-7,8-dimethoxypyrazolo[4,3-c]quinolin-5-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[3-(4-fluorophenyl)-7,8-dimethoxypyrazolo[4,3-c]quinolin-5-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53245599 |
| Molecular Formula | C27H25FN4O2 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 4-[[3-(4-fluorophenyl)-7,8-dimethoxypyrazolo[4,3-c]quinolin-5-yl]methyl]-N,N-dimethylaniline |
| SMILES | COc1cc2c3nnc(-c4ccc(F)cc4)c-3cn(Cc3ccc(N(C)C)cc3)c2cc1OC |
| InChI | InChI=1S/C27H25FN4O2/c1-31(2)20-11-5-17(6-12-20)15-32-16-22-26(18-7-9-19(28)10-8-18)29-30-27(22)21-13-24(33-3)25(34-4)14-23(21)32/h5-14,16H,15H2,1-4H3 |
| InChIKey | XBJVEHNMOKHCMM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|