C18H34O6 — CID 53245652
(2R,3R,4S,5S,6R)-2-(6-cyclohexylhexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53245652) has the molecular formula C18H34O6 and a molecular weight of 346.46 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-(6-cyclohexylhexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-(6-cyclohexylhexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53245652 |
| Molecular Formula | C18H34O6 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-(6-cyclohexylhexoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](OCCCCCCC2CCCCC2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H34O6/c19-12-14-15(20)16(21)17(22)18(24-14)23-11-7-2-1-4-8-13-9-5-3-6-10-13/h13-22H,1-12H2/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | IKXDBGTYPHAFNV-UYTYNIKBSA-N |
| XLogP | 1.33 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|