C23H28NO3+ — CID 53245680
[(1R,5S)-8-[(2R)-2-hydroxy-2-phenylethyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate (PubChem CID 53245680) has the molecular formula C23H28NO3+ and a molecular weight of 366.48 g/mol. Its IUPAC name is [(1R,5S)-8-[(2R)-2-hydroxy-2-phenylethyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate.
| Compound Name | [(1R,5S)-8-[(2R)-2-hydroxy-2-phenylethyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate |
|---|---|
| PubChem CID | 53245680 |
| Molecular Formula | C23H28NO3+ |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | [(1R,5S)-8-[(2R)-2-hydroxy-2-phenylethyl]-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] benzoate |
| SMILES | C[N+]1(C[C@H](O)c2ccccc2)[C@@H]2CC[C@H]1CC(OC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C23H28NO3/c1-24(16-22(25)17-8-4-2-5-9-17)19-12-13-20(24)15-21(14-19)27-23(26)18-10-6-3-7-11-18/h2-11,19-22,25H,12-16H2,1H3/q+1/t19-,20+,21?,22-,24?/m0/s1 |
| InChIKey | UOBMQJGLFUHOEX-JUVJEOJQSA-N |
| XLogP | 3.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|