About 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide
3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide (PubChem CID 53245699) has the molecular formula C22H16N4O2S2
and a molecular weight of 432.53 g/mol. Its IUPAC name is 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide |
| PubChem CID | 53245699 |
| Molecular Formula | C22H16N4O2S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Nc2ncc3ccc4sc(-c5ccccc5)cc4c3n2)c1 |
| InChI | InChI=1S/C22H16N4O2S2/c23-30(27,28)17-8-4-7-16(11-17)25-22-24-13-15-9-10-19-18(21(15)26-22)12-20(29-19)14-5-2-1-3-6-14/h1-13H,(H2,23,27,28)(H,24,25,26) |
| InChIKey | ZSSGEBJSMMYEMX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide?
The IUPAC name of 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide (CID 53245699) is 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide.
What is the SMILES notation for 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide?
The canonical SMILES for 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide is NS(=O)(=O)c1cccc(Nc2ncc3ccc4sc(-c5ccccc5)cc4c3n2)c1.
What is the InChIKey of 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide?
The InChIKey is ZSSGEBJSMMYEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4O2S2/c23-30(27,28)17-8-4-7-16(11-17)25-22-24-13-15-9-10-19-18(21(15)26-22)12-20(29-19)14-5-2-1-3-6-14/h1-13H,(H2,23,27,28)(H,24,25,26).
What are the key properties of 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide?
3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide has a molecular weight of 432.53 g/mol, XLogP of 4.90, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(8-phenylthieno[2,3-h]quinazolin-2-yl)amino]benzenesulfonamide is sourced from PubChem (CID 53245699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).