C28H25N5O3 — CID 53245744
N-[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 53245744) has the molecular formula C28H25N5O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is N-[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53245744 |
| Molecular Formula | C28H25N5O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-[4-(cyclopropylamino)-3,4-dioxo-1-phenylbutan-2-yl]-2-(3-phenylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CC1)C(=O)C(Cc1ccccc1)NC(=O)c1cccnc1-n1ccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C28H25N5O3/c34-25(28(36)30-21-13-14-21)24(18-19-8-3-1-4-9-19)31-27(35)22-12-7-16-29-26(22)33-17-15-23(32-33)20-10-5-2-6-11-20/h1-12,15-17,21,24H,13-14,18H2,(H,30,36)(H,31,35) |
| InChIKey | ROIHCRTXXJIAPG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|